C18H10ClF2N5O — CID 167518349
3-[4-(6-chloro-3-pyridinyl)-5-fluoro-6-methyl-2-pyridinyl]-5-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazole (PubChem CID 167518349) has the molecular formula C18H10ClF2N5O and a molecular weight of 385.76 g/mol. Its IUPAC name is 3-[4-(6-chloro-3-pyridinyl)-5-fluoro-6-methyl-2-pyridinyl]-5-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(6-chloro-3-pyridinyl)-5-fluoro-6-methyl-2-pyridinyl]-5-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167518349 |
| Molecular Formula | C18H10ClF2N5O |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 3-[4-(6-chloro-3-pyridinyl)-5-fluoro-6-methyl-2-pyridinyl]-5-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2noc(-c3ccc(F)cn3)n2)cc(-c2ccc(Cl)nc2)c1F |
| InChI | InChI=1S/C18H10ClF2N5O/c1-9-16(21)12(10-2-5-15(19)23-7-10)6-14(24-9)17-25-18(27-26-17)13-4-3-11(20)8-22-13/h2-8H,1H3 |
| InChIKey | ZYYNJZLGMMABGZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|