C30H31FN2O — CID 16751917
1-butyl-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 16751917) has the molecular formula C30H31FN2O and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-butyl-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 1-butyl-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 16751917 |
| Molecular Formula | C30H31FN2O |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-butyl-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CCCCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C30H31FN2O/c1-4-5-20-33-28(21(2)3)27(30(34)32-25-14-10-7-11-15-25)26(22-12-8-6-9-13-22)29(33)23-16-18-24(31)19-17-23/h6-19,21H,4-5,20H2,1-3H3,(H,32,34) |
| InChIKey | OOIANRVAMLXIGO-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |