C18H20FNO3 — CID 16751955
3-[(1S,2S,3R,5S)-3-fluoro-5-methyl-4-methylidene-2-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one (PubChem CID 16751955) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-[(1S,2S,3R,5S)-3-fluoro-5-methyl-4-methylidene-2-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2S,3R,5S)-3-fluoro-5-methyl-4-methylidene-2-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 16751955 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[(1S,2S,3R,5S)-3-fluoro-5-methyl-4-methylidene-2-phenylcyclohexanecarbonyl]-1,3-oxazolidin-2-one |
| SMILES | C=C1[C@@H](C)C[C@H](C(=O)N2CCOC2=O)[C@@H](c2ccccc2)[C@H]1F |
| InChI | InChI=1S/C18H20FNO3/c1-11-10-14(17(21)20-8-9-23-18(20)22)15(16(19)12(11)2)13-6-4-3-5-7-13/h3-7,11,14-16H,2,8-10H2,1H3/t11-,14-,15+,16-/m0/s1 |
| InChIKey | QGRSPNXIVGSNER-KSYCFECVSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|