C28H34F3N5O4 — CID 167521409
N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167521409) has the molecular formula C28H34F3N5O4 and a molecular weight of 561.61 g/mol. Its IUPAC name is N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167521409 |
| Molecular Formula | C28H34F3N5O4 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
| SMILES | C#Cc1cccc2cncc(C(C#N)NC=O)c12.CO[C@H](C)CC(=O)N1CC(C)C(C)(C)C1.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H9N3O.C12H23NO2.C2H2F3NO/c1-2-10-4-3-5-11-7-16-8-12(14(10)11)13(6-15)17-9-18;1-9-7-13(8-12(9,3)4)11(14)6-10(2)15-5;3-2(4,5)1(6)7/h1,3-5,7-9,13H,(H,17,18);9-10H,6-8H2,1-5H3;(H2,6,7)/t;9?,10-;/m.1./s1 |
| InChIKey | UERXUOPIDUISNM-MUXCAIEMSA-N |
| XLogP | 3.48 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|