C29H32F3N5O3 — CID 167521896
N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;2,2,2-trifluoro-N-[1-(1-methylcyclopropyl)-2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide (PubChem CID 167521896) has the molecular formula C29H32F3N5O3 and a molecular weight of 555.60 g/mol. Its IUPAC name is N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;2,2,2-trifluoro-N-[1-(1-methylcyclopropyl)-2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide.
| Compound Name | N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;2,2,2-trifluoro-N-[1-(1-methylcyclopropyl)-2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 167521896 |
| Molecular Formula | C29H32F3N5O3 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | N-[cyano-(5-ethynylisoquinolin-4-yl)methyl]formamide;2,2,2-trifluoro-N-[1-(1-methylcyclopropyl)-2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
| SMILES | C#Cc1cccc2cncc(C(C#N)NC=O)c12.C[C@H]1CN(C(=O)C(NC(=O)C(F)(F)F)C2(C)CC2)CC1(C)C |
| InChI | InChI=1S/C15H23F3N2O2.C14H9N3O/c1-9-7-20(8-13(9,2)3)11(21)10(14(4)5-6-14)19-12(22)15(16,17)18;1-2-10-4-3-5-11-7-16-8-12(14(10)11)13(6-15)17-9-18/h9-10H,5-8H2,1-4H3,(H,19,22);1,3-5,7-9,13H,(H,17,18)/t9-,10?;/m0./s1 |
| InChIKey | NSCYQTNLRRVQGQ-KKFCBZOWSA-N |
| XLogP | 3.86 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|