C17H15ClN4OS — CID 16752144
N-(4-chlorophenyl)-11-methylsulfanyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide (PubChem CID 16752144) has the molecular formula C17H15ClN4OS and a molecular weight of 358.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-11-methylsulfanyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide.
| Compound Name | N-(4-chlorophenyl)-11-methylsulfanyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide |
|---|---|
| PubChem CID | 16752144 |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(4-chlorophenyl)-11-methylsulfanyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide |
| SMILES | CSc1nn2c3c(cnc2c1C(=O)Nc1ccc(Cl)cc1)CCC3 |
| InChI | InChI=1S/C17H15ClN4OS/c1-24-17-14(16(23)20-12-7-5-11(18)6-8-12)15-19-9-10-3-2-4-13(10)22(15)21-17/h5-9H,2-4H2,1H3,(H,20,23) |
| InChIKey | UICRNGLTJZGDAI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |