C18H34NO2Y- — CID 167522281
CID 167522281 (PubChem CID 167522281) has the molecular formula C18H34NO2Y- and a molecular weight of 385.38 g/mol.
| Compound Name | CID 167522281 |
|---|---|
| PubChem CID | 167522281 |
| Molecular Formula | C18H34NO2Y- |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | — |
| SMILES | CCC.C[C@H](CC(=O)N1[CH-]C2C(C1)C2(C)C)OC(C)(C)C.[Y] |
| InChI | InChI=1S/C15H26NO2.C3H8.Y/c1-10(18-14(2,3)4)7-13(17)16-8-11-12(9-16)15(11,5)6;1-3-2;/h8,10-12H,7,9H2,1-6H3;3H2,1-2H3;/q-1;;/t10-,11?,12?;;/m1../s1 |
| InChIKey | YJBOIYOANGWBNE-DDSAHXNVSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|