C10H13ClN2 — CID 167522541
8-chloro-1-methylimidazo[1,5-a]pyridine;ethane (PubChem CID 167522541) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 8-chloro-1-methylimidazo[1,5-a]pyridine;ethane.
| Compound Name | 8-chloro-1-methylimidazo[1,5-a]pyridine;ethane |
|---|---|
| PubChem CID | 167522541 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 8-chloro-1-methylimidazo[1,5-a]pyridine;ethane |
| SMILES | CC.Cc1ncn2cccc(Cl)c12 |
| InChI | InChI=1S/C8H7ClN2.C2H6/c1-6-8-7(9)3-2-4-11(8)5-10-6;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | OGPYXPLDBVLUME-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |