C10H13N3 — CID 83827507
1-(8-methylimidazo[1,5-a]pyridin-1-yl)ethanamine (PubChem CID 83827507) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(8-methylimidazo[1,5-a]pyridin-1-yl)ethanamine.
| Compound Name | 1-(8-methylimidazo[1,5-a]pyridin-1-yl)ethanamine |
|---|---|
| PubChem CID | 83827507 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(8-methylimidazo[1,5-a]pyridin-1-yl)ethanamine |
| SMILES | Cc1cccn2cnc(C(C)N)c12 |
| InChI | InChI=1S/C10H13N3/c1-7-4-3-5-13-6-12-9(8(2)11)10(7)13/h3-6,8H,11H2,1-2H3 |
| InChIKey | AIIJBTAYBGKNSP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |