C27H30F3N5O3 — CID 167522598
(1R,2S,5S)-N-[(S)-cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167522598) has the molecular formula C27H30F3N5O3 and a molecular weight of 529.56 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(S)-cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(S)-cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167522598 |
| Molecular Formula | C27H30F3N5O3 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (1R,2S,5S)-N-[(S)-cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)N[C@H](C#N)c1cncc3ccccc13)C2(C)C |
| InChI | InChI=1S/C27H30F3N5O3/c1-25(2,3)21(34-24(38)27(28,29)30)23(37)35-13-17-19(26(17,4)5)20(35)22(36)33-18(10-31)16-12-32-11-14-8-6-7-9-15(14)16/h6-9,11-12,17-21H,13H2,1-5H3,(H,33,36)(H,34,38)/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | NHOBLOOBXKWDAG-HGJUEJDCSA-N |
| XLogP | 3.49 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |