C22H36N2O2 — CID 167523417
(3Z,5Z)-6-[6-[(1Z,3Z)-5-imino-2,4-dimethylhexa-1,3-dienoxy]hexoxy]-3,5-dimethylhexa-3,5-dien-2-imine (PubChem CID 167523417) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3Z,5Z)-6-[6-[(1Z,3Z)-5-imino-2,4-dimethylhexa-1,3-dienoxy]hexoxy]-3,5-dimethylhexa-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-6-[6-[(1Z,3Z)-5-imino-2,4-dimethylhexa-1,3-dienoxy]hexoxy]-3,5-dimethylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 167523417 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (3Z,5Z)-6-[6-[(1Z,3Z)-5-imino-2,4-dimethylhexa-1,3-dienoxy]hexoxy]-3,5-dimethylhexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(C)=C\C(C)=C/OCCCCCCO/C=C(C)\C=C(C)/C(C)=N/[H] |
| InChI | InChI=1S/C22H36N2O2/c1-17(13-19(3)21(5)23)15-25-11-9-7-8-10-12-26-16-18(2)14-20(4)22(6)24/h13-16,23-24H,7-12H2,1-6H3/b17-15-,18-16-,19-13-,20-14-,23-21+,24-22+ |
| InChIKey | KXRGXLBNGFGOQB-NUFSEIRWSA-N |
| XLogP | 6.36 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|