C23H28ClN5O4 — CID 167523907
N-[(2S)-1-[[1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-7-chloro-1H-indole-2-carboxamide (PubChem CID 167523907) has the molecular formula C23H28ClN5O4 and a molecular weight of 473.96 g/mol. Its IUPAC name is N-[(2S)-1-[[1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-7-chloro-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-7-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167523907 |
| Molecular Formula | C23H28ClN5O4 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[(2S)-1-[[1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-7-chloro-1H-indole-2-carboxamide |
| SMILES | NC(=O)C(C[C@@H]1CCCNC1=O)NC(=O)[C@H](CC1CC1)NC(=O)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C23H28ClN5O4/c24-15-5-1-3-13-10-18(27-19(13)15)23(33)29-17(9-12-6-7-12)22(32)28-16(20(25)30)11-14-4-2-8-26-21(14)31/h1,3,5,10,12,14,16-17,27H,2,4,6-9,11H2,(H2,25,30)(H,26,31)(H,28,32)(H,29,33)/t14-,16?,17-/m0/s1 |
| InChIKey | BXVXEOBIHITAAK-NZEUDUFCSA-N |
| XLogP | 1.61 |
| TPSA | 146.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |