C24H29ClN4O5 — CID 175458447
methyl 2-[[2-[(7-chloro-1H-indole-2-carbonyl)amino]-3-cyclopropylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate (PubChem CID 175458447) has the molecular formula C24H29ClN4O5 and a molecular weight of 488.97 g/mol. Its IUPAC name is methyl 2-[[2-[(7-chloro-1H-indole-2-carbonyl)amino]-3-cyclopropylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate.
| Compound Name | methyl 2-[[2-[(7-chloro-1H-indole-2-carbonyl)amino]-3-cyclopropylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 175458447 |
| Molecular Formula | C24H29ClN4O5 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | methyl 2-[[2-[(7-chloro-1H-indole-2-carbonyl)amino]-3-cyclopropylpropanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanoate |
| SMILES | COC(=O)C(C[C@@H]1CCCNC1=O)NC(=O)C(CC1CC1)NC(=O)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C24H29ClN4O5/c1-34-24(33)19(12-15-5-3-9-26-21(15)30)29-22(31)17(10-13-7-8-13)28-23(32)18-11-14-4-2-6-16(25)20(14)27-18/h2,4,6,11,13,15,17,19,27H,3,5,7-10,12H2,1H3,(H,26,30)(H,28,32)(H,29,31)/t15-,17?,19?/m0/s1 |
| InChIKey | CZKZGEDUHKXUKJ-DMKPSLHHSA-N |
| XLogP | 2.29 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |