C12H9F3N4O — CID 167524955
2-(1,2,4-oxadiazol-3-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 167524955) has the molecular formula C12H9F3N4O and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-3-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-(1,2,4-oxadiazol-3-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 167524955 |
| Molecular Formula | C12H9F3N4O |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-(1,2,4-oxadiazol-3-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | Nc1cccc2c1cc(-c1ncon1)n2CC(F)(F)F |
| InChI | InChI=1S/C12H9F3N4O/c13-12(14,15)5-19-9-3-1-2-8(16)7(9)4-10(19)11-17-6-20-18-11/h1-4,6H,5,16H2 |
| InChIKey | XBVLDACQJVJJDN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|