C18H26N4O2 — CID 167526042
N-[3-(3,5-dimethylpiperidin-1-yl)-4-(hydrazinecarbonyl)phenyl]cyclopropanecarboxamide (PubChem CID 167526042) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)-4-(hydrazinecarbonyl)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)-4-(hydrazinecarbonyl)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167526042 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)-4-(hydrazinecarbonyl)phenyl]cyclopropanecarboxamide |
| SMILES | CC1CC(C)CN(c2cc(NC(=O)C3CC3)ccc2C(=O)NN)C1 |
| InChI | InChI=1S/C18H26N4O2/c1-11-7-12(2)10-22(9-11)16-8-14(20-17(23)13-3-4-13)5-6-15(16)18(24)21-19/h5-6,8,11-13H,3-4,7,9-10,19H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | IAXXVXHLRMAYBE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|