C23H31N5O — CID 167526043
N-[3-(3,5-dimethylpiperidin-1-yl)-4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-3-yl)phenyl]cyclopropanecarboxamide (PubChem CID 167526043) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)-4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-3-yl)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)-4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-3-yl)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167526043 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)-4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-3-yl)phenyl]cyclopropanecarboxamide |
| SMILES | CC1CC(C)CN(c2cc(NC(=O)C3CC3)ccc2-c2ncc3n2CCNC3)C1 |
| InChI | InChI=1S/C23H31N5O/c1-15-9-16(2)14-27(13-15)21-10-18(26-23(29)17-3-4-17)5-6-20(21)22-25-12-19-11-24-7-8-28(19)22/h5-6,10,12,15-17,24H,3-4,7-9,11,13-14H2,1-2H3,(H,26,29) |
| InChIKey | MJQYWSZYPPUDHM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |