C22H18ClFN2O2 — CID 167526480
2-chloro-1-[(2S)-7-[(4-fluorophenyl)methyl]-2-phenyl-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone (PubChem CID 167526480) has the molecular formula C22H18ClFN2O2 and a molecular weight of 396.85 g/mol. Its IUPAC name is 2-chloro-1-[(2S)-7-[(4-fluorophenyl)methyl]-2-phenyl-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[(2S)-7-[(4-fluorophenyl)methyl]-2-phenyl-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone |
|---|---|
| PubChem CID | 167526480 |
| Molecular Formula | C22H18ClFN2O2 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-chloro-1-[(2S)-7-[(4-fluorophenyl)methyl]-2-phenyl-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]ethanone |
| SMILES | O=C(CCl)N1c2cc(Cc3ccc(F)cc3)cnc2OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H18ClFN2O2/c23-12-21(27)26-19-11-16(10-15-6-8-18(24)9-7-15)13-25-22(19)28-14-20(26)17-4-2-1-3-5-17/h1-9,11,13,20H,10,12,14H2/t20-/m1/s1 |
| InChIKey | PYSPJAXSZGBXGN-HXUWFJFHSA-N |
| XLogP | 4.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|