C18H15NO4 — CID 16752650
2-[2-(4-methylphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 16752650) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[2-(4-methylphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 16752650 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[2-(4-methylphenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1ccc(CCN2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1 |
| InChI | InChI=1S/C18H15NO4/c1-11-2-4-12(5-3-11)8-9-19-16(20)14-7-6-13(18(22)23)10-15(14)17(19)21/h2-7,10H,8-9H2,1H3,(H,22,23) |
| InChIKey | OXJPLXDLZUEDMK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|