C14H10N2O6 — CID 25195297
2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 25195297) has the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 25195297 |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C(=O)O)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C14H10N2O6/c17-10-4-3-9(11(18)15-10)16-12(19)7-2-1-6(14(21)22)5-8(7)13(16)20/h1-2,5,9H,3-4H2,(H,21,22)(H,15,17,18) |
| InChIKey | YIBCNIAUDQMKRO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|