C19H26ClFN6OSi — CID 167528995
6-chloro-4-(1,4-dimethylpyrazol-5-yl)-3-fluoro-N-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyridin-2-amine (PubChem CID 167528995) has the molecular formula C19H26ClFN6OSi and a molecular weight of 437.00 g/mol. Its IUPAC name is 6-chloro-4-(1,4-dimethylpyrazol-5-yl)-3-fluoro-N-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyridin-2-amine.
| Compound Name | 6-chloro-4-(1,4-dimethylpyrazol-5-yl)-3-fluoro-N-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 167528995 |
| Molecular Formula | C19H26ClFN6OSi |
| Molecular Weight | 437.00 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-chloro-4-(1,4-dimethylpyrazol-5-yl)-3-fluoro-N-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyridin-2-amine |
| SMILES | Cc1cnn(C)c1-c1cc(Cl)nc(Nc2ccnn2COCC[Si](C)(C)C)c1F |
| InChI | InChI=1S/C19H26ClFN6OSi/c1-13-11-23-26(2)18(13)14-10-15(20)24-19(17(14)21)25-16-6-7-22-27(16)12-28-8-9-29(3,4)5/h6-7,10-11H,8-9,12H2,1-5H3,(H,24,25) |
| InChIKey | YPSRDDDWDZRELY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.00 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|