C16H20BrF2N3O3 — CID 167529627
2-methylpropyl 2-[(6-bromo-5-fluoro-3-methyl-2-pyridinyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 167529627) has the molecular formula C16H20BrF2N3O3 and a molecular weight of 420.25 g/mol. Its IUPAC name is 2-methylpropyl 2-[(6-bromo-5-fluoro-3-methyl-2-pyridinyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | 2-methylpropyl 2-[(6-bromo-5-fluoro-3-methyl-2-pyridinyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167529627 |
| Molecular Formula | C16H20BrF2N3O3 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-methylpropyl 2-[(6-bromo-5-fluoro-3-methyl-2-pyridinyl)carbamoyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | Cc1cc(F)c(Br)nc1NC(=O)C1CC(F)CN1C(=O)OCC(C)C |
| InChI | InChI=1S/C16H20BrF2N3O3/c1-8(2)7-25-16(24)22-6-10(18)5-12(22)15(23)21-14-9(3)4-11(19)13(17)20-14/h4,8,10,12H,5-7H2,1-3H3,(H,20,21,23) |
| InChIKey | KSNZHJRJUQSPHP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|