C16H20BrClN2O3 — CID 5188630
2-methylpropyl 2-[(3-bromo-4-chlorophenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 5188630) has the molecular formula C16H20BrClN2O3 and a molecular weight of 403.70 g/mol. Its IUPAC name is 2-methylpropyl 2-[(3-bromo-4-chlorophenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | 2-methylpropyl 2-[(3-bromo-4-chlorophenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 5188630 |
| Molecular Formula | C16H20BrClN2O3 |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-methylpropyl 2-[(3-bromo-4-chlorophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCCC1C(=O)Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C16H20BrClN2O3/c1-10(2)9-23-16(22)20-7-3-4-14(20)15(21)19-11-5-6-13(18)12(17)8-11/h5-6,8,10,14H,3-4,7,9H2,1-2H3,(H,19,21) |
| InChIKey | GSWMABDFSRBSHF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |