C26H24N4O6S — CID 167529936
ethyl (2E)-2-[(2E)-3-benzyl-2-[[2-(1-methyl-2-oxoquinolin-4-yl)oxyacetyl]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 167529936) has the molecular formula C26H24N4O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is ethyl (2E)-2-[(2E)-3-benzyl-2-[[2-(1-methyl-2-oxoquinolin-4-yl)oxyacetyl]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(2E)-3-benzyl-2-[[2-(1-methyl-2-oxoquinolin-4-yl)oxyacetyl]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 167529936 |
| Molecular Formula | C26H24N4O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | ethyl (2E)-2-[(2E)-3-benzyl-2-[[2-(1-methyl-2-oxoquinolin-4-yl)oxyacetyl]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/S/C(=N/NC(=O)COc2cc(=O)n(C)c3ccccc23)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H24N4O6S/c1-3-35-24(33)14-21-25(34)30(15-17-9-5-4-6-10-17)26(37-21)28-27-22(31)16-36-20-13-23(32)29(2)19-12-8-7-11-18(19)20/h4-14H,3,15-16H2,1-2H3,(H,27,31)/b21-14+,28-26+ |
| InChIKey | KULZMONJXGQOON-NYLKEHOHSA-N |
| XLogP | 2.53 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|