C20H17N5O7S — CID 154584456
ethyl (2Z)-2-[(2Z)-3-benzyl-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 154584456) has the molecular formula C20H17N5O7S and a molecular weight of 471.45 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2Z)-3-benzyl-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(2Z)-3-benzyl-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 154584456 |
| Molecular Formula | C20H17N5O7S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | ethyl (2Z)-2-[(2Z)-3-benzyl-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\S/C(=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H17N5O7S/c1-2-32-18(26)11-17-19(27)23(12-13-6-4-3-5-7-13)20(33-17)22-21-15-9-8-14(24(28)29)10-16(15)25(30)31/h3-11,21H,2,12H2,1H3/b17-11-,22-20- |
| InChIKey | GOGZSHZSRKNZIQ-YJGHASPHSA-N |
| XLogP | 3.41 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|