C23H22N4O3S2 — CID 167530598
(E)-3-(4-methoxyphenyl)-1-[4-[3-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)sulfanyl]propoxy]phenyl]prop-2-en-1-one (PubChem CID 167530598) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-[4-[3-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)sulfanyl]propoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-[4-[3-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)sulfanyl]propoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167530598 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-[4-[3-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)sulfanyl]propoxy]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OCCCSc3nn4c(C)nnc4s3)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-16-24-25-22-27(16)26-23(32-22)31-15-3-14-30-20-11-7-18(8-12-20)21(28)13-6-17-4-9-19(29-2)10-5-17/h4-13H,3,14-15H2,1-2H3/b13-6+ |
| InChIKey | KEALCEUVUPUVON-AWNIVKPZSA-N |
| XLogP | 4.96 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|