C27H21FN4O2S2 — CID 167530615
(E)-3-(4-fluorophenyl)-1-[4-[2-[[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]sulfanyl]ethoxy]phenyl]prop-2-en-1-one (PubChem CID 167530615) has the molecular formula C27H21FN4O2S2 and a molecular weight of 516.62 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-[4-[2-[[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]sulfanyl]ethoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-[4-[2-[[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]sulfanyl]ethoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167530615 |
| Molecular Formula | C27H21FN4O2S2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-[4-[2-[[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]sulfanyl]ethoxy]phenyl]prop-2-en-1-one |
| SMILES | Cc1ccc(-c2nnc3sc(SCCOc4ccc(C(=O)/C=C/c5ccc(F)cc5)cc4)nn23)cc1 |
| InChI | InChI=1S/C27H21FN4O2S2/c1-18-2-7-21(8-3-18)25-29-30-26-32(25)31-27(36-26)35-17-16-34-23-13-9-20(10-14-23)24(33)15-6-19-4-11-22(28)12-5-19/h2-15H,16-17H2,1H3/b15-6+ |
| InChIKey | VXERAYHDELBOEN-GIDUJCDVSA-N |
| XLogP | 6.37 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|