C11H13ClF3N — CID 167531090
N-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine (PubChem CID 167531090) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is N-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 167531090 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H13ClF3N/c1-7(2)16-6-8-5-9(12)3-4-10(8)11(13,14)15/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | BHQDMMBTLQWTGH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |