C16H15ClF3N — CID 66160299
N-[[5-chloro-2-(3,4,5-trifluorophenyl)phenyl]methyl]propan-2-amine (PubChem CID 66160299) has the molecular formula C16H15ClF3N and a molecular weight of 313.75 g/mol. Its IUPAC name is N-[[5-chloro-2-(3,4,5-trifluorophenyl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[5-chloro-2-(3,4,5-trifluorophenyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66160299 |
| Molecular Formula | C16H15ClF3N |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[[5-chloro-2-(3,4,5-trifluorophenyl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc(Cl)ccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H15ClF3N/c1-9(2)21-8-11-5-12(17)3-4-13(11)10-6-14(18)16(20)15(19)7-10/h3-7,9,21H,8H2,1-2H3 |
| InChIKey | CQYBUHZHUWURPX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|