C25H28N4O2 — CID 167533215
3-(isoquinolin-5-ylmethoxy)-1-[8-(5-methyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one (PubChem CID 167533215) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-(isoquinolin-5-ylmethoxy)-1-[8-(5-methyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one.
| Compound Name | 3-(isoquinolin-5-ylmethoxy)-1-[8-(5-methyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 167533215 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 3-(isoquinolin-5-ylmethoxy)-1-[8-(5-methyl-2-pyridinyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propan-1-one |
| SMILES | Cc1ccc(N2C3CCC2CN(C(=O)CCOCc2cccc4cnccc24)C3)nc1 |
| InChI | InChI=1S/C25H28N4O2/c1-18-5-8-24(27-13-18)29-21-6-7-22(29)16-28(15-21)25(30)10-12-31-17-20-4-2-3-19-14-26-11-9-23(19)20/h2-5,8-9,11,13-14,21-22H,6-7,10,12,15-17H2,1H3 |
| InChIKey | DYGUTGVVRZSWDN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|