C26H22ClFN4O3 — CID 167534600
3-[2-[5-(3-amino-2-chlorophenoxy)-2-pyridinyl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one (PubChem CID 167534600) has the molecular formula C26H22ClFN4O3 and a molecular weight of 492.94 g/mol. Its IUPAC name is 3-[2-[5-(3-amino-2-chlorophenoxy)-2-pyridinyl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one.
| Compound Name | 3-[2-[5-(3-amino-2-chlorophenoxy)-2-pyridinyl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one |
|---|---|
| PubChem CID | 167534600 |
| Molecular Formula | C26H22ClFN4O3 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 3-[2-[5-(3-amino-2-chlorophenoxy)-2-pyridinyl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one |
| SMILES | CC(C)n1cc(-c2ccc(F)cc2)c(=O)c(C(=O)Cc2ccc(Oc3cccc(N)c3Cl)cn2)n1 |
| InChI | InChI=1S/C26H22ClFN4O3/c1-15(2)32-14-20(16-6-8-17(28)9-7-16)26(34)25(31-32)22(33)12-18-10-11-19(13-30-18)35-23-5-3-4-21(29)24(23)27/h3-11,13-15H,12,29H2,1-2H3 |
| InChIKey | ZCEBHOIEMZXZES-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|