C25H21ClFN5O3 — CID 167653562
3-[2-[2-(3-amino-2-chlorophenoxy)pyrimidin-5-yl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one (PubChem CID 167653562) has the molecular formula C25H21ClFN5O3 and a molecular weight of 493.93 g/mol. Its IUPAC name is 3-[2-[2-(3-amino-2-chlorophenoxy)pyrimidin-5-yl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one.
| Compound Name | 3-[2-[2-(3-amino-2-chlorophenoxy)pyrimidin-5-yl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one |
|---|---|
| PubChem CID | 167653562 |
| Molecular Formula | C25H21ClFN5O3 |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[2-[2-(3-amino-2-chlorophenoxy)pyrimidin-5-yl]acetyl]-5-(4-fluorophenyl)-1-propan-2-ylpyridazin-4-one |
| SMILES | CC(C)n1cc(-c2ccc(F)cc2)c(=O)c(C(=O)Cc2cnc(Oc3cccc(N)c3Cl)nc2)n1 |
| InChI | InChI=1S/C25H21ClFN5O3/c1-14(2)32-13-18(16-6-8-17(27)9-7-16)24(34)23(31-32)20(33)10-15-11-29-25(30-12-15)35-21-5-3-4-19(28)22(21)26/h3-9,11-14H,10,28H2,1-2H3 |
| InChIKey | JMYJFMDCYJDEOH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|