C20H41N3 — CID 167538514
1-[2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-4-(2-methylpropyl)piperazine (PubChem CID 167538514) has the molecular formula C20H41N3 and a molecular weight of 323.57 g/mol. Its IUPAC name is 1-[2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-4-(2-methylpropyl)piperazine.
| Compound Name | 1-[2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-4-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 167538514 |
| Molecular Formula | C20H41N3 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.33 |
| IUPAC Name | 1-[2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-4-(2-methylpropyl)piperazine |
| SMILES | CC(C)CCN1CCC(CCN2CCN(CC(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H41N3/c1-18(2)5-9-21-10-6-20(7-11-21)8-12-22-13-15-23(16-14-22)17-19(3)4/h18-20H,5-17H2,1-4H3 |
| InChIKey | BMBNDYOVXHDWDO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |