About ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine
ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine (PubChem CID 176985881) has the molecular formula C26H58N2
and a molecular weight of 398.76 g/mol. Its IUPAC name is ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine |
| PubChem CID | 176985881 |
| Molecular Formula | C26H58N2 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.46 |
| IUPAC Name | ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine |
| SMILES | CC.CC.CC(C)CCC1CCN(C)CC1.CC(C)CCN1CCC(C)CC1 |
| InChI | InChI=1S/2C11H23N.2C2H6/c1-10(2)4-7-12-8-5-11(3)6-9-12;1-10(2)4-5-11-6-8-12(3)9-7-11;2*1-2/h2*10-11H,4-9H2,1-3H3;2*1-2H3 |
| InChIKey | YCHHEZVAWSHQDU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine?
The IUPAC name of ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine (CID 176985881) is ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine.
What is the SMILES notation for ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine?
The canonical SMILES for ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine is CC.CC.CC(C)CCC1CCN(C)CC1.CC(C)CCN1CCC(C)CC1.
What is the InChIKey of ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine?
The InChIKey is YCHHEZVAWSHQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H23N.2C2H6/c1-10(2)4-7-12-8-5-11(3)6-9-12;1-10(2)4-5-11-6-8-12(3)9-7-11;2*1-2/h2*10-11H,4-9H2,1-3H3;2*1-2H3.
What are the key properties of ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine?
ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine has a molecular weight of 398.76 g/mol, XLogP of 7.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-(3-methylbutyl)piperidine;4-methyl-1-(3-methylbutyl)piperidine is sourced from PubChem (CID 176985881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).