C9H17N3O2S — CID 167540335
1-[2-(2,2-dimethylpropylsulfonyl)ethyl]triazole (PubChem CID 167540335) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpropylsulfonyl)ethyl]triazole.
| Compound Name | 1-[2-(2,2-dimethylpropylsulfonyl)ethyl]triazole |
|---|---|
| PubChem CID | 167540335 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-[2-(2,2-dimethylpropylsulfonyl)ethyl]triazole |
| SMILES | CC(C)(C)CS(=O)(=O)CCn1ccnn1 |
| InChI | InChI=1S/C9H17N3O2S/c1-9(2,3)8-15(13,14)7-6-12-5-4-10-11-12/h4-5H,6-8H2,1-3H3 |
| InChIKey | BSVKOKCREXRVIV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |