C18H18N6O2 — CID 167542563
3-[2-[1-(3-methoxypropyl)pyrazolo[4,3-b]pyridin-3-yl]-4-pyridinyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 167542563) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-[2-[1-(3-methoxypropyl)pyrazolo[4,3-b]pyridin-3-yl]-4-pyridinyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[2-[1-(3-methoxypropyl)pyrazolo[4,3-b]pyridin-3-yl]-4-pyridinyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167542563 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-[2-[1-(3-methoxypropyl)pyrazolo[4,3-b]pyridin-3-yl]-4-pyridinyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | COCCCn1nc(-c2cc(-c3noc(C)n3)ccn2)c2ncccc21 |
| InChI | InChI=1S/C18H18N6O2/c1-12-21-18(23-26-12)13-6-8-19-14(11-13)16-17-15(5-3-7-20-17)24(22-16)9-4-10-25-2/h3,5-8,11H,4,9-10H2,1-2H3 |
| InChIKey | BJOMAJOIXMBRCN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|