C28H28N2O6 — CID 167542947
1,1-diphenylpropan-2-yl (2S)-2-[[3-acetyloxy-4-(2-oxoethyl)pyridine-2-carbonyl]amino]propanoate (PubChem CID 167542947) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 1,1-diphenylpropan-2-yl (2S)-2-[[3-acetyloxy-4-(2-oxoethyl)pyridine-2-carbonyl]amino]propanoate.
| Compound Name | 1,1-diphenylpropan-2-yl (2S)-2-[[3-acetyloxy-4-(2-oxoethyl)pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 167542947 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 1,1-diphenylpropan-2-yl (2S)-2-[[3-acetyloxy-4-(2-oxoethyl)pyridine-2-carbonyl]amino]propanoate |
| SMILES | CC(=O)Oc1c(CC=O)ccnc1C(=O)N[C@@H](C)C(=O)OC(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O6/c1-18(30-27(33)25-26(36-20(3)32)23(15-17-31)14-16-29-25)28(34)35-19(2)24(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-14,16-19,24H,15H2,1-3H3,(H,30,33)/t18-,19?/m0/s1 |
| InChIKey | BKUDOAQRUFMWEM-OYKVQYDMSA-N |
| XLogP | 3.63 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|