C32H38N6O4 — CID 167543558
1-[4-(7-methyl-6-morpholin-4-ylpurin-2-yl)phenyl]-3-[4-(2-morpholin-4-ylethoxymethyl)phenyl]propan-2-one (PubChem CID 167543558) has the molecular formula C32H38N6O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is 1-[4-(7-methyl-6-morpholin-4-ylpurin-2-yl)phenyl]-3-[4-(2-morpholin-4-ylethoxymethyl)phenyl]propan-2-one.
| Compound Name | 1-[4-(7-methyl-6-morpholin-4-ylpurin-2-yl)phenyl]-3-[4-(2-morpholin-4-ylethoxymethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 167543558 |
| Molecular Formula | C32H38N6O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 1-[4-(7-methyl-6-morpholin-4-ylpurin-2-yl)phenyl]-3-[4-(2-morpholin-4-ylethoxymethyl)phenyl]propan-2-one |
| SMILES | Cn1cnc2nc(-c3ccc(CC(=O)Cc4ccc(COCCN5CCOCC5)cc4)cc3)nc(N3CCOCC3)c21 |
| InChI | InChI=1S/C32H38N6O4/c1-36-23-33-31-29(36)32(38-13-18-41-19-14-38)35-30(34-31)27-8-6-25(7-9-27)21-28(39)20-24-2-4-26(5-3-24)22-42-17-12-37-10-15-40-16-11-37/h2-9,23H,10-22H2,1H3 |
| InChIKey | JXDDRUCOBSWWNQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|