C23H17FN2O2 — CID 167545651
N-(2-fluoro-4-methylphenyl)-3-(8-hydroxyquinolin-6-yl)benzamide (PubChem CID 167545651) has the molecular formula C23H17FN2O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-3-(8-hydroxyquinolin-6-yl)benzamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-3-(8-hydroxyquinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 167545651 |
| Molecular Formula | C23H17FN2O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-3-(8-hydroxyquinolin-6-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(-c3cc(O)c4ncccc4c3)c2)c(F)c1 |
| InChI | InChI=1S/C23H17FN2O2/c1-14-7-8-20(19(24)10-14)26-23(28)17-5-2-4-15(11-17)18-12-16-6-3-9-25-22(16)21(27)13-18/h2-13,27H,1H3,(H,26,28) |
| InChIKey | ZQCZJOYMQJNIGI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |