C18H22N6O5S — CID 167548809
N-[5-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]amino]acetyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide (PubChem CID 167548809) has the molecular formula C18H22N6O5S and a molecular weight of 434.48 g/mol. Its IUPAC name is N-[5-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]amino]acetyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]amino]acetyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167548809 |
| Molecular Formula | C18H22N6O5S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[5-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)acetyl]amino]acetyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)NCC(=O)c1cccc2nc(NC(=O)C3CC3)nn12 |
| InChI | InChI=1S/C18H22N6O5S/c25-14(10-19-16(26)11-23-6-8-30(28,29)9-7-23)13-2-1-3-15-20-18(22-24(13)15)21-17(27)12-4-5-12/h1-3,12H,4-11H2,(H,19,26)(H,21,22,27) |
| InChIKey | VMWWEMXDNKVJRT-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |