C27H36N4O4 — CID 167549629
tert-butyl 4-[3-(4-methoxycarbonylcyclohexyl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-11-yl]piperidine-1-carboxylate (PubChem CID 167549629) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-methoxycarbonylcyclohexyl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-11-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-methoxycarbonylcyclohexyl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-11-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167549629 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | tert-butyl 4-[3-(4-methoxycarbonylcyclohexyl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-11-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)C1CCC(C2=CCc3ncc4nc(C5CCN(C(=O)OC(C)(C)C)CC5)cn4c32)CC1 |
| InChI | InChI=1S/C27H36N4O4/c1-27(2,3)35-26(33)30-13-11-18(12-14-30)22-16-31-23(29-22)15-28-21-10-9-20(24(21)31)17-5-7-19(8-6-17)25(32)34-4/h9,15-19H,5-8,10-14H2,1-4H3 |
| InChIKey | PJYRLLXWQIWNGG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |