C13H29O3P — CID 167549752
3-[3-methoxypropyl(3-propan-2-yloxypropyl)phosphanyl]propan-1-ol (PubChem CID 167549752) has the molecular formula C13H29O3P and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[3-methoxypropyl(3-propan-2-yloxypropyl)phosphanyl]propan-1-ol.
| Compound Name | 3-[3-methoxypropyl(3-propan-2-yloxypropyl)phosphanyl]propan-1-ol |
|---|---|
| PubChem CID | 167549752 |
| Molecular Formula | C13H29O3P |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 3-[3-methoxypropyl(3-propan-2-yloxypropyl)phosphanyl]propan-1-ol |
| SMILES | COCCCP(CCCO)CCCOC(C)C |
| InChI | InChI=1S/C13H29O3P/c1-13(2)16-9-6-12-17(10-4-7-14)11-5-8-15-3/h13-14H,4-12H2,1-3H3 |
| InChIKey | QDQDSEWJSSHZCW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|