C16H28FNO3 — CID 167550228
tert-butyl (3R,4R)-4-cyclohexyloxy-3-fluoropiperidine-1-carboxylate (PubChem CID 167550228) has the molecular formula C16H28FNO3 and a molecular weight of 301.40 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-cyclohexyloxy-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-cyclohexyloxy-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167550228 |
| Molecular Formula | C16H28FNO3 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | tert-butyl (3R,4R)-4-cyclohexyloxy-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](OC2CCCCC2)[C@H](F)C1 |
| InChI | InChI=1S/C16H28FNO3/c1-16(2,3)21-15(19)18-10-9-14(13(17)11-18)20-12-7-5-4-6-8-12/h12-14H,4-11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | QIMLDKGOYVXCPW-ZIAGYGMSSA-N |
| XLogP | 3.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |