C28H48N5O5PSi — CID 167553037
3-[[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-(2-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 167553037) has the molecular formula C28H48N5O5PSi and a molecular weight of 593.78 g/mol. Its IUPAC name is 3-[[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-(2-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-(2-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 167553037 |
| Molecular Formula | C28H48N5O5PSi |
| Molecular Weight | 593.78 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | 3-[[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-(2-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC[C@H]1O[C@@H](n2ccc3c(=O)[nH]c(C)nc32)C(O[Si](C)(C)C(C)(C)C)[C@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C28H48N5O5PSi/c1-12-22-23(37-39(35-17-13-15-29)33(18(2)3)19(4)5)24(38-40(10,11)28(7,8)9)27(36-22)32-16-14-21-25(32)30-20(6)31-26(21)34/h14,16,18-19,22-24,27H,12-13,17H2,1-11H3,(H,30,31,34)/t22-,23+,24?,27-,39?/m1/s1 |
| InChIKey | CQSMGSKIYBJDDG-CFMBFPBTSA-N |
| XLogP | 6.39 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|