C29H25F3N6O3 — CID 167554247
4-imidazo[1,2-a]pyridin-3-yl-5-[10-(piperidine-1-carbonyl)-6-(trifluoromethyl)-1,2,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione (PubChem CID 167554247) has the molecular formula C29H25F3N6O3 and a molecular weight of 562.55 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-3-yl-5-[10-(piperidine-1-carbonyl)-6-(trifluoromethyl)-1,2,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione.
| Compound Name | 4-imidazo[1,2-a]pyridin-3-yl-5-[10-(piperidine-1-carbonyl)-6-(trifluoromethyl)-1,2,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 167554247 |
| Molecular Formula | C29H25F3N6O3 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-3-yl-5-[10-(piperidine-1-carbonyl)-6-(trifluoromethyl)-1,2,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(c2cnc3ccccn23)=C1c1nn2c3c(cc(C(F)(F)F)cc13)CN(C(=O)N1CCCCC1)CC2 |
| InChI | InChI=1S/C29H25F3N6O3/c30-29(31,32)18-12-17-16-36(28(41)35-7-3-1-4-8-35)10-11-38-27(17)19(13-18)26(34-38)25-22(40)14-21(39)24(25)20-15-33-23-6-2-5-9-37(20)23/h2,5-6,9,12-13,15H,1,3-4,7-8,10-11,14,16H2 |
| InChIKey | CULNVENWARFQIN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|