C17H16F2N6O2 — CID 167554249
[(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[4-(5-aminopyrimidin-2-yl)-1-methylpyrazol-5-yl]acetate (PubChem CID 167554249) has the molecular formula C17H16F2N6O2 and a molecular weight of 374.35 g/mol. Its IUPAC name is [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[4-(5-aminopyrimidin-2-yl)-1-methylpyrazol-5-yl]acetate.
| Compound Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[4-(5-aminopyrimidin-2-yl)-1-methylpyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 167554249 |
| Molecular Formula | C17H16F2N6O2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] 2-[4-(5-aminopyrimidin-2-yl)-1-methylpyrazol-5-yl]acetate |
| SMILES | C[C@@H](OC(=O)Cc1c(-c2ncc(N)cn2)cnn1C)c1cc(F)cnc1F |
| InChI | InChI=1S/C17H16F2N6O2/c1-9(12-3-10(18)5-21-16(12)19)27-15(26)4-14-13(8-24-25(14)2)17-22-6-11(20)7-23-17/h3,5-9H,4,20H2,1-2H3/t9-/m1/s1 |
| InChIKey | BAITYQNDTJLDKG-SECBINFHSA-N |
| XLogP | 1.98 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|