C23H24N2O3 — CID 167556214
[2-[(3S)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-phenylphenyl]methanediol (PubChem CID 167556214) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [2-[(3S)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-phenylphenyl]methanediol.
| Compound Name | [2-[(3S)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-phenylphenyl]methanediol |
|---|---|
| PubChem CID | 167556214 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [2-[(3S)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-phenylphenyl]methanediol |
| SMILES | Cc1ccc(O[C@H]2CCN(c3ccc(-c4ccccc4)cc3C(O)O)C2)nc1 |
| InChI | InChI=1S/C23H24N2O3/c1-16-7-10-22(24-14-16)28-19-11-12-25(15-19)21-9-8-18(13-20(21)23(26)27)17-5-3-2-4-6-17/h2-10,13-14,19,23,26-27H,11-12,15H2,1H3/t19-/m0/s1 |
| InChIKey | ZFCFRWYFGCEDOV-IBGZPJMESA-N |
| XLogP | 3.70 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|