C22H22N2O — CID 167682110
5-methyl-2-[(3S)-1-(2-phenylphenyl)pyrrolidin-3-yl]oxypyridine (PubChem CID 167682110) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-methyl-2-[(3S)-1-(2-phenylphenyl)pyrrolidin-3-yl]oxypyridine.
| Compound Name | 5-methyl-2-[(3S)-1-(2-phenylphenyl)pyrrolidin-3-yl]oxypyridine |
|---|---|
| PubChem CID | 167682110 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 5-methyl-2-[(3S)-1-(2-phenylphenyl)pyrrolidin-3-yl]oxypyridine |
| SMILES | Cc1ccc(O[C@H]2CCN(c3ccccc3-c3ccccc3)C2)nc1 |
| InChI | InChI=1S/C22H22N2O/c1-17-11-12-22(23-15-17)25-19-13-14-24(16-19)21-10-6-5-9-20(21)18-7-3-2-4-8-18/h2-12,15,19H,13-14,16H2,1H3/t19-/m0/s1 |
| InChIKey | IPPUWXHWQDBJGX-IBGZPJMESA-N |
| XLogP | 4.71 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |