C19H39NO3 — CID 16755624
N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]formamide (PubChem CID 16755624) has the molecular formula C19H39NO3 and a molecular weight of 329.53 g/mol. Its IUPAC name is N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]formamide.
| Compound Name | N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]formamide |
|---|---|
| PubChem CID | 16755624 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]formamide |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@H](CO)NC=O |
| InChI | InChI=1S/C19H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(23)18(16-21)20-17-22/h17-19,21,23H,2-16H2,1H3,(H,20,22)/t18-,19+/m0/s1 |
| InChIKey | XSDVOEIEBUGRQX-RBUKOAKNSA-N |
| XLogP | 3.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|