C19H28O2 — CID 167558138
(6E,8E,12Z,14E,16E)-2-hydroxy-2-methyloctadeca-6,8,12,14,16-pentaen-5-one (PubChem CID 167558138) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (6E,8E,12Z,14E,16E)-2-hydroxy-2-methyloctadeca-6,8,12,14,16-pentaen-5-one.
| Compound Name | (6E,8E,12Z,14E,16E)-2-hydroxy-2-methyloctadeca-6,8,12,14,16-pentaen-5-one |
|---|---|
| PubChem CID | 167558138 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (6E,8E,12Z,14E,16E)-2-hydroxy-2-methyloctadeca-6,8,12,14,16-pentaen-5-one |
| SMILES | C/C=C/C=C/C=C\CC/C=C/C=C/C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C19H28O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(20)16-17-19(2,3)21/h4-9,12-15,21H,10-11,16-17H2,1-3H3/b5-4+,7-6+,9-8-,13-12+,15-14+ |
| InChIKey | VXAAPOGSEPYTAK-JDXPBYPHSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|