C18H34N2O4 — CID 167559829
8-(4-methylpiperazin-1-yl)-1-[2-(2-oxopropoxy)ethoxy]octan-4-one (PubChem CID 167559829) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is 8-(4-methylpiperazin-1-yl)-1-[2-(2-oxopropoxy)ethoxy]octan-4-one.
| Compound Name | 8-(4-methylpiperazin-1-yl)-1-[2-(2-oxopropoxy)ethoxy]octan-4-one |
|---|---|
| PubChem CID | 167559829 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 8-(4-methylpiperazin-1-yl)-1-[2-(2-oxopropoxy)ethoxy]octan-4-one |
| SMILES | CC(=O)COCCOCCCC(=O)CCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H34N2O4/c1-17(21)16-24-15-14-23-13-5-7-18(22)6-3-4-8-20-11-9-19(2)10-12-20/h3-16H2,1-2H3 |
| InChIKey | ICFVKFITRZCQKZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|